Online Database of Chemicals from Around the World
|
CAS#: 93917-69-2 Product: 2-Methyl-4-Oxo-4H-Pyran-3-Yl 3-Methyl-2-Butenoate No suppilers available for the product. |
| Name | 2-Methyl-4-Oxo-4H-Pyran-3-Yl 3-Methyl-2-Butenoate |
|---|---|
| Synonyms | (2-Methyl-4-Oxo-Pyran-3-Yl) 3-Methylbut-2-Enoate; 3-Methylbut-2-Enoic Acid (2-Methyl-4-Oxo-3-Pyranyl) Ester; 3-Methylbut-2-Enoic Acid (4-Keto-2-Methyl-Pyran-3-Yl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 93917-69-2 |
| EINECS | 299-847-9 |
| SMILES | CC1=C(OC(=O)C=C(C)C)C(=O)C=CO1 |
| InChI | 1S/C11H12O4/c1-7(2)6-10(13)15-11-8(3)14-5-4-9(11)12/h4-6H,1-3H3 |
| InChIKey | RGFWHIQAWJMOBE-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.128°C at 760 mmHg (Cal.) |
| Flash point | 157.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Oxo-4H-Pyran-3-Yl 3-Methyl-2-Butenoate |