|
CAS#: 93904-65-5 Product: 7-Chloro-1,1-Dimethylindan-4-Ol No suppilers available for the product. |
| Name | 7-Chloro-1,1-Dimethylindan-4-Ol |
|---|---|
| Synonyms | 7-Chloro-1,1-Dimethyl-Indan-4-Ol; 7-Chloro-1,1-Dimethyl-4-Indanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 |
| CAS Registry Number | 93904-65-5 |
| EINECS | 299-804-4 |
| SMILES | C1=C(Cl)C2=C(C(=C1)O)CCC2(C)C |
| InChI | 1S/C11H13ClO/c1-11(2)6-5-7-9(13)4-3-8(12)10(7)11/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | KZOVKESZCFEXNY-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.497°C at 760 mmHg (Cal.) |
| Flash point | 127.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-1,1-Dimethylindan-4-Ol |