|
CAS#: 93918-86-6 Product: 1,1'-[(3,5-Dimethylphenyl)imino]di(2-butanol) No suppilers available for the product. |
| Name | 1,1'-[(3,5-Dimethylphenyl)imino]di(2-butanol) |
|---|---|
| Synonyms | 1,1'-[(3,5-dimethylphenyl)imino]bis(butan-2-ol) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.39 |
| CAS Registry Number | 93918-86-6 |
| EINECS | 299-967-1 |
| SMILES | CCC(O)CN(CC(O)CC)c1cc(C)cc(C)c1 |
| InChI | 1S/C16H27NO2/c1-5-15(18)10-17(11-16(19)6-2)14-8-12(3)7-13(4)9-14/h7-9,15-16,18-19H,5-6,10-11H2,1-4H3 |
| InChIKey | MNHPEUKMVUMQQH-UHFFFAOYSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.035°C at 760 mmHg (Cal.) |
| Flash point | 209.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(3,5-Dimethylphenyl)imino]di(2-butanol) |