|
CAS#: 93919-06-3 Product: Benzyl Hydrogen 2-Butenedioate No suppilers available for the product. |
| Name | Benzyl Hydrogen 2-Butenedioate |
|---|---|
| Synonyms | (E)-4-(Benzyloxy)-4-Keto-But-2-Enoic Acid; Benzyl Hydrogen 2-Butenedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 93919-06-3 |
| EINECS | 299-989-1 |
| SMILES | C1=C(COC(=O)\C=C\C(O)=O)C=CC=C1 |
| InChI | 1S/C11H10O4/c12-10(13)6-7-11(14)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)/b7-6+ |
| InChIKey | QKUGKZFASYQCGO-VOTSOKGWSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.428°C at 760 mmHg (Cal.) |
| Flash point | 145.761°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl Hydrogen 2-Butenedioate |