|
CAS#: 93923-79-6 Product: 2-(1,1-Dimethyl-2-Phenylethyl)-5,5-Dimethyl-1,3-Dioxane No suppilers available for the product. |
| Name | 2-(1,1-Dimethyl-2-Phenylethyl)-5,5-Dimethyl-1,3-Dioxane |
|---|---|
| Synonyms | 2-(1,1-Dimethyl-2-Phenyl-Ethyl)-5,5-Dimethyl-1,3-Dioxane; 2-(1,1-Dimethyl-2-Phenylethyl)-5,5-Dimethyl-1,3-Dioxane; 5,5-Dimethyl-2-(2-Methyl-1-Phenyl-Propan-2-Yl)-1,3-Dioxane |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 93923-79-6 |
| EINECS | 300-168-8 |
| SMILES | C2=C(CC(C1OCC(CO1)(C)C)(C)C)C=CC=C2 |
| InChI | 1S/C16H24O2/c1-15(2)11-17-14(18-12-15)16(3,4)10-13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3 |
| InChIKey | XWTCEZISKNEYKD-UHFFFAOYSA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.285°C at 760 mmHg (Cal.) |
| Flash point | 159.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,1-Dimethyl-2-Phenylethyl)-5,5-Dimethyl-1,3-Dioxane |