|
CAS#: 93941-02-7 Product: Isopropyl 1H-Indole-3-Propionate No suppilers available for the product. |
| Name | Isopropyl 1H-Indole-3-Propionate |
|---|---|
| Synonyms | Isopropyl 3-(1H-Indol-3-Yl)Propanoate; 3-(1H-Indol-3-Yl)Propanoic Acid Isopropyl Ester; 3-(1H-Indol-3-Yl)Propionic Acid Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 93941-02-7 |
| EINECS | 300-501-7 |
| SMILES | C2=C(C1=CC=CC=C1[NH]2)CCC(=O)OC(C)C |
| InChI | 1S/C14H17NO2/c1-10(2)17-14(16)8-7-11-9-15-13-6-4-3-5-12(11)13/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | ALEBZUNFHDQURI-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.789°C at 760 mmHg (Cal.) |
| Flash point | 179.861°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 1H-Indole-3-Propionate |