Online Database of Chemicals from Around the World
|
CAS#: 93941-75-4 Product: 2,9-Bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-4,7-dione No suppilers available for the product. |
| Name | 2,9-Bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-4,7-dione |
|---|---|
| Synonyms | 2,9-bis(a |
| Molecular Structure | ![CAS#: 93941-75-4, 2,9-Bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-4,7-dione](/moreStructures/93941-75-4.gif) |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.30 |
| CAS Registry Number | 93941-75-4 |
| EINECS | 300-524-2 |
| SMILES | O=C2CCC(=O)OC(CN)c1ccc(cc1)C(CN)O2 |
| InChI | 1S/C14H18N2O4/c15-7-11-9-1-2-10(4-3-9)12(8-16)20-14(18)6-5-13(17)19-11/h1-4,11-12H,5-8,15-16H2 |
| InChIKey | TVJRPDWUZJHLAE-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.78°C at 760 mmHg (Cal.) |
| Flash point | 317.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,9-Bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-4,7-dione |