|
CAS#: 93942-50-8 Product: 1-(5-Isopropyl-2-Methyl-1-Cyclohexen-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | 1-(5-Isopropyl-2-Methyl-1-Cyclohexen-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | (E)-1-(5-Isopropyl-2-Methyl-1-Cyclohexenyl)But-2-En-1-One; 1-(5-Isopropyl-2-Methyl-1-Cyclohexen-1-Yl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 93942-50-8 |
| EINECS | 300-603-1 |
| SMILES | CC(C1CC(=C(CC1)C)C(=O)\C=C\C)C |
| InChI | 1S/C14H22O/c1-5-6-14(15)13-9-12(10(2)3)8-7-11(13)4/h5-6,10,12H,7-9H2,1-4H3/b6-5+ |
| InChIKey | PIRRESNWUUEAOS-AATRIKPKSA-N |
| Density | 0.914g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.723°C at 760 mmHg (Cal.) |
| Flash point | 120.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(5-Isopropyl-2-Methyl-1-Cyclohexen-1-Yl)-2-Buten-1-One |