|
CAS#: 93942-57-5 Product: (2',3'-Dichloro-2-biphenylyl)(oxo)acetic acid No suppilers available for the product. |
| Name | (2',3'-Dichloro-2-biphenylyl)(oxo)acetic acid |
|---|---|
| Synonyms | (2,3-dichlorophenyl)oxophenylacetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2O3 |
| Molecular Weight | 295.12 |
| CAS Registry Number | 93942-57-5 |
| EINECS | 300-611-5 |
| SMILES | Clc1c(cccc1Cl)c2ccccc2C(=O)C(O)=O |
| InChI | 1S/C14H8Cl2O3/c15-11-7-3-6-9(12(11)16)8-4-1-2-5-10(8)13(17)14(18)19/h1-7H,(H,18,19) |
| InChIKey | DOOTZRZHTNHQET-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.587°C at 760 mmHg (Cal.) |
| Flash point | 222.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2',3'-Dichloro-2-biphenylyl)(oxo)acetic acid |