|
CAS#: 93962-65-3 Product: 6-Chloro-2-(4-chlorophenyl)-4-chromanol No suppilers available for the product. |
| Name | 6-Chloro-2-(4-chlorophenyl)-4-chromanol |
|---|---|
| Synonyms | 6-chloro-2-(4-chlorophenyl)-3,4-dihydro-2H-1-benzopyran-4-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.16 |
| CAS Registry Number | 93962-65-3 |
| EINECS | 300-703-5 |
| SMILES | Clc1ccc(cc1)C2CC(O)c3cc(Cl)ccc3O2 |
| InChI | 1S/C15H12Cl2O2/c16-10-3-1-9(2-4-10)15-8-13(18)12-7-11(17)5-6-14(12)19-15/h1-7,13,15,18H,8H2 |
| InChIKey | HJRISVMHODKYKM-UHFFFAOYSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.798°C at 760 mmHg (Cal.) |
| Flash point | 215.549°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-2-(4-chlorophenyl)-4-chromanol |