|
CAS#: 93963-30-5 Product: 2-Bromoethyl 2-phenylbicyclo[2.2.1]heptane-2-carboxylate No suppilers available for the product. |
| Name | 2-Bromoethyl 2-phenylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.22 |
| CAS Registry Number | 93963-30-5 |
| EINECS | 300-772-1 |
| SMILES | BrCCOC(=O)C2(CC1CCC2C1)c3ccccc3 |
| InChI | 1S/C16H19BrO2/c17-8-9-19-15(18)16(13-4-2-1-3-5-13)11-12-6-7-14(16)10-12/h1-5,12,14H,6-11H2 |
| InChIKey | BQKFZAGPKKRDNM-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.846°C at 760 mmHg (Cal.) |
| Flash point | 198.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromoethyl 2-phenylbicyclo[2.2.1]heptane-2-carboxylate |