|
CAS#: 93962-68-6 Product: 3-(5-Chloro-2-Hydroxyphenyl)-1-(4-Chlorophenyl)Propan-1-One No suppilers available for the product. |
| Name | 3-(5-Chloro-2-Hydroxyphenyl)-1-(4-Chlorophenyl)Propan-1-One |
|---|---|
| Synonyms | 3-(5-Chloro-2-Hydroxy-Phenyl)-1-(4-Chlorophenyl)Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.16 |
| CAS Registry Number | 93962-68-6 |
| EINECS | 300-706-1 |
| SMILES | C1=C(Cl)C=CC(=C1CCC(=O)C2=CC=C(Cl)C=C2)O |
| InChI | 1S/C15H12Cl2O2/c16-12-4-1-10(2-5-12)14(18)7-3-11-9-13(17)6-8-15(11)19/h1-2,4-6,8-9,19H,3,7H2 |
| InChIKey | MEQOQDZHCOVXMB-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.989°C at 760 mmHg (Cal.) |
| Flash point | 238.041°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(5-Chloro-2-Hydroxyphenyl)-1-(4-Chlorophenyl)Propan-1-One |