|
CAS#: 93962-85-7 Product: Ammonium 2,3-Diheptylnaphthalene-1-sulphonate No suppilers available for the product. |
| Name | Ammonium 2,3-Diheptylnaphthalene-1-sulphonate |
|---|---|
| Synonyms | Ammonium 2,3-Diheptylnaphthalene-1-Sulfonate; Ammonium 2,3-Diheptyl-1-Naphthalenesulfonate; Ammonium Diheptylnaphthalenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H39NO3S |
| Molecular Weight | 421.64 |
| CAS Registry Number | 93962-85-7 |
| EINECS | 300-725-5 |
| SMILES | C1=C(C(=C([S]([O-])(=O)=O)C2=CC=CC=C12)CCCCCCC)CCCCCCC.[NH4+] |
| InChI | 1S/C24H36O3S.H3N/c1-3-5-7-9-11-15-20-19-21-16-13-14-18-23(21)24(28(25,26)27)22(20)17-12-10-8-6-4-2;/h13-14,16,18-19H,3-12,15,17H2,1-2H3,(H,25,26,27);1H3 |
| InChIKey | UWASBNOHSIELBY-UHFFFAOYSA-N |
| Boiling point | 602.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 318.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2,3-Diheptylnaphthalene-1-sulphonate |