Online Database of Chemicals from Around the World
|
CAS#: 93963-27-0 Product: 3-Chloro-N-[4-Chloro-2-(Anilino)Phenyl]Propionamide No suppilers available for the product. |
| Name | 3-Chloro-N-[4-Chloro-2-(Anilino)Phenyl]Propionamide |
|---|---|
| Synonyms | 3-Chloro-N-[4-Chloro-2-(Phenylamino)Phenyl]Propionamide; 3-Chloro-N-(4-Chloro-2-(Anilino)Phenyl)Propionamide |
| Molecular Structure | ![CAS#: 93963-27-0, 3-Chloro-N-[4-Chloro-2-(Anilino)Phenyl]Propionamide](/moreStructures/93963-27-0.gif) |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.19 |
| CAS Registry Number | 93963-27-0 |
| EINECS | 300-769-5 |
| SMILES | C1=C(Cl)C=CC(=C1NC2=CC=CC=C2)NC(=O)CCCl |
| InChI | 1S/C15H14Cl2N2O/c16-9-8-15(20)19-13-7-6-11(17)10-14(13)18-12-4-2-1-3-5-12/h1-7,10,18H,8-9H2,(H,19,20) |
| InChIKey | FFTZQCADOSDDJO-UHFFFAOYSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.359°C at 760 mmHg (Cal.) |
| Flash point | 247.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-N-[4-Chloro-2-(Anilino)Phenyl]Propionamide |