|
CAS#: 93963-37-2 Product: 2,2-Dimethyl-1-Phenylpentan-3-Ol No suppilers available for the product. |
| Name | 2,2-Dimethyl-1-Phenylpentan-3-Ol |
|---|---|
| Synonyms | 2,2-Dimethyl-1-Phenyl-Pentan-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 93963-37-2 |
| EINECS | 300-780-5 |
| SMILES | C1=C(CC(C(O)CC)(C)C)C=CC=C1 |
| InChI | 1S/C13H20O/c1-4-12(14)13(2,3)10-11-8-6-5-7-9-11/h5-9,12,14H,4,10H2,1-3H3 |
| InChIKey | VQTSUDONSIEYQP-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.42°C at 760 mmHg (Cal.) |
| Flash point | 111.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-1-Phenylpentan-3-Ol |