|
CAS#: 93963-74-7 Product: (6alpha,20R)-11,17,20-Trihydroxy-6-methyl-3-oxopregna-1,4-dien-21-yl acetate No suppilers available for the product. |
| Name | (6alpha,20R)-11,17,20-Trihydroxy-6-methyl-3-oxopregna-1,4-dien-21-yl acetate |
|---|---|
| Synonyms | (20R)-11β |
| Molecular Structure | ![]() |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.52 |
| CAS Registry Number | 93963-74-7 |
| EINECS | 300-818-0 |
| SMILES | CC(=O)OC[C@@H](O)[C@@]4(O)CC[C@H]3[C@@H]2C[C@H](C)C1=CC(=O)C=C[C@]1(C)[C@H]2[C@@H](O)C[C@@]34C |
| InChI | 1S/C24H34O6/c1-13-9-16-17-6-8-24(29,20(28)12-30-14(2)25)23(17,4)11-19(27)21(16)22(3)7-5-15(26)10-18(13)22/h5,7,10,13,16-17,19-21,27-29H,6,8-9,11-12H2,1-4H3/t13-,16-,17-,19-,20+,21+,22-,23-,24-/m0/s1 |
| InChIKey | PISINOWVXAIVLQ-OCKJIAMASA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.444°C at 760 mmHg (Cal.) |
| Flash point | 203.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6alpha,20R)-11,17,20-Trihydroxy-6-methyl-3-oxopregna-1,4-dien-21-yl acetate |