|
CAS#: 939760-82-4 Product: 6,8-Dichloro-1,2-dihydronaphthalene No suppilers available for the product. |
| Name | 6,8-Dichloro-1,2-dihydronaphthalene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2 |
| Molecular Weight | 199.08 |
| CAS Registry Number | 939760-82-4 |
| SMILES | Clc2cc(Cl)c1c(\C=C/CC1)c2 |
| InChI | 1S/C10H8Cl2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1,3,5-6H,2,4H2 |
| InChIKey | HMEJYVJSAKBKBV-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.752°C at 760 mmHg (Cal.) |
| Flash point | 126.326°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dichloro-1,2-dihydronaphthalene |