|
CAS#: 93980-94-0 Product: 2,4-Bis(2-Methylphenoxy)-1-Nitrobenzene No suppilers available for the product. |
| Name | 2,4-Bis(2-Methylphenoxy)-1-Nitrobenzene |
|---|---|
| Synonyms | 2,4-Bis(2-Methylphenoxy)-1-Nitro-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 |
| CAS Registry Number | 93980-94-0 |
| EINECS | 301-075-5 |
| SMILES | C2=C(OC1=C(C=CC=C1)C)C=CC(=C2OC3=CC=CC=C3C)[N+]([O-])=O |
| InChI | 1S/C20H17NO4/c1-14-7-3-5-9-18(14)24-16-11-12-17(21(22)23)20(13-16)25-19-10-6-4-8-15(19)2/h3-13H,1-2H3 |
| InChIKey | AGUUXLHIEOFRGU-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.662°C at 760 mmHg (Cal.) |
| Flash point | 159.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(2-Methylphenoxy)-1-Nitrobenzene |