|
CAS#: 93982-45-7 Product: Diethyl[2-(2-Hydroxyethoxy)Ethyl]Methylammonium Methyl Sulphate No suppilers available for the product. |
| Name | Diethyl[2-(2-Hydroxyethoxy)Ethyl]Methylammonium Methyl Sulphate |
|---|---|
| Synonyms | [1,1-Diethyl-3-(2-Hydroxyethoxy)Propyl]Ammonium; Methyl Sulfate; Diethyl(2-(2-Hydroxyethoxy)Ethyl)Methylammonium Methyl Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25NO6S |
| Molecular Weight | 287.37 |
| CAS Registry Number | 93982-45-7 |
| EINECS | 301-233-3 |
| SMILES | CO[S]([O-])(=O)=O.C(C([NH3+])(CC)CC)COCCO |
| InChI | 1S/C9H21NO2.CH4O4S/c1-3-9(10,4-2)5-7-12-8-6-11;1-5-6(2,3)4/h11H,3-8,10H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | DVFFUAMXTIJYQU-UHFFFAOYSA-N |
| Boiling point | 446.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 223.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl[2-(2-Hydroxyethoxy)Ethyl]Methylammonium Methyl Sulphate |