|
CAS#: 93982-98-0 Product: 4-Chloro-N-(5-Ethyl-2-Hydroxyphenyl)Benzamide No suppilers available for the product. |
| Name | 4-Chloro-N-(5-Ethyl-2-Hydroxyphenyl)Benzamide |
|---|---|
| Synonyms | 4-Chloro-N-(5-Ethyl-2-Hydroxy-Phenyl)Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73 |
| CAS Registry Number | 93982-98-0 |
| EINECS | 301-285-7 |
| SMILES | C1=C(C=CC(=C1NC(=O)C2=CC=C(Cl)C=C2)O)CC |
| InChI | 1S/C15H14ClNO2/c1-2-10-3-8-14(18)13(9-10)17-15(19)11-4-6-12(16)7-5-11/h3-9,18H,2H2,1H3,(H,17,19) |
| InChIKey | ZLBNQXDATOISEF-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.333°C at 760 mmHg (Cal.) |
| Flash point | 165.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-N-(5-Ethyl-2-Hydroxyphenyl)Benzamide |