|
CAS#: 94022-06-7 Product: 1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl phenylacetate No suppilers available for the product. |
| Name | 1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl phenylacetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.38 |
| CAS Registry Number | 94022-06-7 |
| EINECS | 301-499-0 |
| SMILES | O=C(OC2CC1CCC2(C1(C)C)C)Cc3ccccc3 |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.116°C at 760 mmHg (Cal.) |
| Flash point | 156.669°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl phenylacetate |