|
CAS#: 94022-19-2 Product: 2,6-Dicyclopentyl-m-Cresol No suppilers available for the product. |
| Name | 2,6-Dicyclopentyl-m-Cresol |
|---|---|
| Synonyms | 2,6-Dicyclopentyl-3-Methyl-Phenol; 2,6-Dicyclopentyl-M-Cresol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 |
| CAS Registry Number | 94022-19-2 |
| EINECS | 301-514-0 |
| SMILES | C3=C(C1CCCC1)C(=C(C2CCCC2)C(=C3)C)O |
| InChI | 1S/C17H24O/c1-12-10-11-15(13-6-2-3-7-13)17(18)16(12)14-8-4-5-9-14/h10-11,13-14,18H,2-9H2,1H3 |
| InChIKey | ORSUQDMEHLIUNE-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.701°C at 760 mmHg (Cal.) |
| Flash point | 130.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dicyclopentyl-m-Cresol |