|
CAS#: 94022-30-7 Product: 2-[3-(2-Chlorophenyl)Propyl]Pyridine No suppilers available for the product. |
| Name | 2-[3-(2-Chlorophenyl)Propyl]Pyridine |
|---|---|
| Synonyms | 2-(3-(2-Chlorophenyl)Propyl)Pyridine; Pyridine, 2-(3-(2-Chlorophenyl)Propyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.72 |
| CAS Registry Number | 94022-30-7 |
| EINECS | 301-526-6 |
| SMILES | C1=C(C(=CC=C1)Cl)CCCC2=NC=CC=C2 |
| InChI | 1S/C14H14ClN/c15-14-10-2-1-6-12(14)7-5-9-13-8-3-4-11-16-13/h1-4,6,8,10-11H,5,7,9H2 |
| InChIKey | JCXMZCZNFXDTRS-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.56°C at 760 mmHg (Cal.) |
| Flash point | 180.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-(2-Chlorophenyl)Propyl]Pyridine |