|
CAS#: 94086-49-4 Product: Zinc 2,2-Dimethylhexanoate No suppilers available for the product. |
| Name | Zinc 2,2-Dimethylhexanoate |
|---|---|
| Synonyms | Zinc Dimethylhexanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15O2Zn |
| Molecular Weight | 208.59 |
| CAS Registry Number | 94086-49-4 |
| EINECS | 301-837-7 |
| SMILES | C(C(C([O-])=O)(C)C)CCC.[Zn++] |
| InChI | 1S/C8H16O2.Zn/c1-4-5-6-8(2,3)7(9)10;/h4-6H2,1-3H3,(H,9,10);/q;+2/p-1 |
| InChIKey | VSUZKKMMFWYGDC-UHFFFAOYSA-M |
| Boiling point | 227.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc 2,2-Dimethylhexanoate |