|
CAS#: 94088-67-2 Product: 2-Chlorophenyl 2-Nitrobenzenesulphonate No suppilers available for the product. |
| Name | 2-Chlorophenyl 2-Nitrobenzenesulphonate |
|---|---|
| Synonyms | 2-Nitrobenzenesulfonic Acid (2-Chlorophenyl) Ester; Chlorophenyl 2-Nitrobenzenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNO5S |
| Molecular Weight | 313.71 |
| CAS Registry Number | 94088-67-2 |
| EINECS | 302-069-5 |
| SMILES | C1=CC=CC(=C1[S](OC2=C(Cl)C=CC=C2)(=O)=O)[N+]([O-])=O |
| InChI | 1S/C12H8ClNO5S/c13-9-5-1-3-7-11(9)19-20(17,18)12-8-4-2-6-10(12)14(15)16/h1-8H |
| InChIKey | XSSJOUMWWSBEKI-UHFFFAOYSA-N |
| Density | 1.516g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.326°C at 760 mmHg (Cal.) |
| Flash point | 247.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chlorophenyl 2-Nitrobenzenesulphonate |