|
CAS#: 94088-96-7 Product: N-[N-(Chloroacetyl)-DL-Leucyl]Glycine No suppilers available for the product. |
| Name | N-[N-(Chloroacetyl)-DL-Leucyl]Glycine |
|---|---|
| Synonyms | 2-[[2-[(2-Chloroacetyl)Amino]-4-Methyl-Pentanoyl]Amino]Acetic Acid; 2-[[2-[(2-Chloro-1-Oxoethyl)Amino]-4-Methyl-1-Oxopentyl]Amino]Acetic Acid; 2-[[2-(2-Chloroethanoylamino)-4-Methyl-Pentanoyl]Amino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17ClN2O4 |
| Molecular Weight | 264.71 |
| CAS Registry Number | 94088-96-7 |
| EINECS | 302-098-3 |
| SMILES | C(C(C(NCC(O)=O)=O)NC(CCl)=O)C(C)C |
| InChI | 1S/C10H17ClN2O4/c1-6(2)3-7(13-8(14)4-11)10(17)12-5-9(15)16/h6-7H,3-5H2,1-2H3,(H,12,17)(H,13,14)(H,15,16) |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.225°C at 760 mmHg (Cal.) |
| Flash point | 294.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[N-(Chloroacetyl)-DL-Leucyl]Glycine |