|
CAS#: 94088-73-0 Product: 6-Nitro-5H-dibenzo[a,c][7]annulene-5,7(6H)-dione No suppilers available for the product. |
| Name | 6-Nitro-5H-dibenzo[a,c][7]annulene-5,7(6H)-dione |
|---|---|
| Synonyms | 6-nitro-5H-dibenzo[a,c]cycloheptene-5,7(6H)-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.24 |
| CAS Registry Number | 94088-73-0 |
| EINECS | 302-075-8 |
| SMILES | [O-][N+](=O)C2C(=O)c3ccccc3c1ccccc1C2=O |
| InChI | 1S/C15H9NO4/c17-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15(18)13(14)16(19)20/h1-8,13H |
| InChIKey | NKKHMOVEDDICJL-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.757°C at 760 mmHg (Cal.) |
| Flash point | 259.234°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Nitro-5H-dibenzo[a,c][7]annulene-5,7(6H)-dione |