|
CAS#: 94088-94-5 Product: 3,3'-Sulfonyldipropanoyl chloride No suppilers available for the product. |
| Name | 3,3'-Sulfonyldipropanoyl chloride |
|---|---|
| Synonyms | 3,3'-sulphonyldipropionyl dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Cl2O4S |
| Molecular Weight | 247.10 |
| CAS Registry Number | 94088-94-5 |
| EINECS | 302-096-2 |
| SMILES | O=C(Cl)CCS(=O)(=O)CCC(Cl)=O |
| InChI | 1S/C6H8Cl2O4S/c7-5(9)1-3-13(11,12)4-2-6(8)10/h1-4H2 |
| InChIKey | IGGIVQUWQUIPLQ-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.103°C at 760 mmHg (Cal.) |
| Flash point | 206.056°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Sulfonyldipropanoyl chloride |