|
CAS#: 94094-44-7 Product: 3-(2-Pyridyl)-3-(p-Tolyl)Propan-1-Ol No suppilers available for the product. |
| Name | 3-(2-Pyridyl)-3-(p-Tolyl)Propan-1-Ol |
|---|---|
| Synonyms | 3-(4-Methylphenyl)-3-(2-Pyridyl)Propan-1-Ol; 3-(4-Methylphenyl)-3-Pyridin-2-Yl-Propan-1-Ol; 3-(2-Pyridyl)-3-(P-Tolyl)Propan-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 |
| CAS Registry Number | 94094-44-7 |
| EINECS | 302-145-8 |
| SMILES | C1=CC=CC(=N1)C(C2=CC=C(C=C2)C)CCO |
| InChI | 1S/C15H17NO/c1-12-5-7-13(8-6-12)14(9-11-17)15-4-2-3-10-16-15/h2-8,10,14,17H,9,11H2,1H3 |
| InChIKey | PMJDJIICWDIDQO-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.037°C at 760 mmHg (Cal.) |
| Flash point | 183.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Pyridyl)-3-(p-Tolyl)Propan-1-Ol |