|
CAS#: 94107-74-1 Product: P,P'-[[(3,5,5-trimethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[[(3,5,5-trimethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C11H31N3O6P2 |
| Molecular Weight | 363.33 |
| CAS Registry Number | 94107-74-1 |
| EINECS | 302-309-9 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCC(C)CC(C)(C)C |
| InChI | 1S/C11H27NO6P2.2H3N/c1-10(7-11(2,3)4)5-6-12(8-19(13,14)15)9-20(16,17)18;;/h10H,5-9H2,1-4H3,(H2,13,14,15)(H2,16,17,18);2*1H3/p-2 |
| InChIKey | PIYLVOZEPSGBOJ-UHFFFAOYSA-L |
| Boiling point | 600.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 316.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[[(3,5,5-trimethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |