|
CAS#: 94108-05-1 Product: N-Butyryl-L-cystine No suppilers available for the product. |
| Name | N-Butyryl-L-cystine |
|---|---|
| Synonyms | N-(1-oxobutyl)-L-cystine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O5S2 |
| Molecular Weight | 310.39 |
| CAS Registry Number | 94108-05-1 |
| EINECS | 302-342-9 |
| SMILES | N[C@@H](CSSC[C@H](NC(=O)CCC)C(O)=O)C(O)=O |
| InChI | 1S/C10H18N2O5S2/c1-2-3-8(13)12-7(10(16)17)5-19-18-4-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | DZLKMQVMKBHIIE-BQBZGAKWSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 596.204°C at 760 mmHg (Cal.) |
| Flash point | 314.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butyryl-L-cystine |