|
CAS#: 94108-03-9 Product: Betaine D-Gluconate No suppilers available for the product. |
| Name | Betaine D-Gluconate |
|---|---|
| Synonyms | Carboxymethyl-Trimethyl-Ammonium; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoate; Carboxymethyl-Trimethylammonium; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoate; Carboxymethyl-Trimethyl-Azanium; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H23NO9 |
| Molecular Weight | 313.30 |
| CAS Registry Number | 94108-03-9 |
| EINECS | 302-340-8 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)CO)[C@@H](O)C([O-])=O.C([N+](C)(C)C)C(=O)O |
| InChI | 1S/C6H12O7.C5H11NO2/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-6(2,3)4-5(7)8/h2-5,7-11H,1H2,(H,12,13);4H2,1-3H3/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | UQBXMPGEPBEEAU-JJKGCWMISA-N |
| Boiling point | 673.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 375.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Betaine D-Gluconate |