|
CAS#: 94108-78-8 Product: Ethyl 5-(ethylsulfonyl)-2-methoxybenzoate No suppilers available for the product. |
| Name | Ethyl 5-(ethylsulfonyl)-2-methoxybenzoate |
|---|---|
| Synonyms | ethyl 5-(ethylsulphonyl)-o-anisate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 |
| CAS Registry Number | 94108-78-8 |
| EINECS | 302-416-0 |
| SMILES | COc1ccc(cc1C(=O)OCC)S(=O)(=O)CC |
| InChI | 1S/C12H16O5S/c1-4-17-12(13)10-8-9(18(14,15)5-2)6-7-11(10)16-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | HOFKFECQUOZJFJ-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.237°C at 760 mmHg (Cal.) |
| Flash point | 223.677°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-(ethylsulfonyl)-2-methoxybenzoate |