Online Database of Chemicals from Around the World
|
CAS#: 94108-54-0 Product: 1-[[4-(Trifluoromethoxy)Phenyl]Sulphonyl]-4-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-[[4-(Trifluoromethoxy)Phenyl]Sulphonyl]-4-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 1-((4-(Trifluoromethoxy)Phenyl)Sulphonyl)-4-(Trifluoromethyl)Benzene |
| Molecular Structure | ![CAS#: 94108-54-0, 1-[[4-(Trifluoromethoxy)Phenyl]Sulphonyl]-4-(Trifluoromethyl)Benzene](/moreStructures/94108-54-0.gif) |
| Molecular Formula | C14H8F6O3S |
| Molecular Weight | 370.27 |
| CAS Registry Number | 94108-54-0 |
| EINECS | 302-395-8 |
| SMILES | C2=C([S](=O)(=O)C1=CC=C(OC(F)(F)F)C=C1)C=CC(=C2)C(F)(F)F |
| InChI | 1S/C14H8F6O3S/c15-13(16,17)9-1-5-11(6-2-9)24(21,22)12-7-3-10(4-8-12)23-14(18,19)20/h1-8H |
| InChIKey | CLOVKDBAOCJVED-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.519°C at 760 mmHg (Cal.) |
| Flash point | 180.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[[4-(Trifluoromethoxy)Phenyl]Sulphonyl]-4-(Trifluoromethyl)Benzene |