|
CAS#: 94109-78-1 Product: 3',6'-Dihydroxy-3H-spiro[2-benzofuran-1,9'-thioxanthen]-3-one No suppilers available for the product. |
| Name | 3',6'-Dihydroxy-3H-spiro[2-benzofuran-1,9'-thioxanthen]-3-one |
|---|---|
| Synonyms | 3',6'-dih |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O4S |
| Molecular Weight | 348.37 |
| CAS Registry Number | 94109-78-1 |
| EINECS | 302-518-5 |
| SMILES | O=C2OC4(c1ccccc12)c5ccc(O)cc5Sc3cc(O)ccc34 |
| InChI | 1S/C20H12O4S/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)24-20/h1-10,21-22H |
| InChIKey | PTTMNOGNUQNMFO-UHFFFAOYSA-N |
| Density | 1.619g/cm3 (Cal.) |
|---|---|
| Boiling point | 641.641°C at 760 mmHg (Cal.) |
| Flash point | 341.852°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',6'-Dihydroxy-3H-spiro[2-benzofuran-1,9'-thioxanthen]-3-one |