|
CAS#: 94133-63-8 Product: Oxalate 1,3-Dichloro-alpha-[2-(Dibutylamino)Ethyl]-6-(Trifluoromethyl)Phenanthrene-9-Methanolate No suppilers available for the product. |
| Name | Oxalate 1,3-Dichloro-alpha-[2-(Dibutylamino)Ethyl]-6-(Trifluoromethyl)Phenanthrene-9-Methanolate |
|---|---|
| Synonyms | oxalate 1 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H29Cl2F3NO5 |
| Molecular Weight | 587.44 |
| CAS Registry Number | 94133-63-8 |
| EINECS | 302-725-0 |
| SMILES | [O-]C(=O)C([O-])=O.FC(F)(F)c2ccc3c(cc1c(Cl)cc(Cl)cc1c3c2)C([O-])CCN(CCCC)CCCC |
| InChI | 1S/C26H29Cl2F3NO.C2H2O4/c1-3-5-10-32(11-6-4-2)12-9-25(33)23-16-22-21(14-18(27)15-24(22)28)20-13-17(26(29,30)31)7-8-19(20)23;3-1(4)2(5)6/h7-8,13-16,25H,3-6,9-12H2,1-2H3;(H,3,4)(H,5,6)/q-1;/p-2 |
| InChIKey | RJBCZMQASKVSGM-UHFFFAOYSA-L |
| Boiling point | 734.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxalate 1,3-Dichloro-alpha-[2-(Dibutylamino)Ethyl]-6-(Trifluoromethyl)Phenanthrene-9-Methanolate |