|
CAS#: 94134-17-5 Product: 1-[3-(Diethylamino)Propyl]Biguanide Monohydrochloride No suppilers available for the product. |
| Name | 1-[3-(Diethylamino)Propyl]Biguanide Monohydrochloride |
|---|---|
| Synonyms | 1-(Diaminomethylene)-2-(3-Diethylaminopropyl)Guanidine Hydrochloride; 1-(3-(Diethylamino)Propyl)Biguanide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H23ClN6 |
| Molecular Weight | 250.77 |
| CAS Registry Number | 94134-17-5 |
| EINECS | 302-784-2 |
| SMILES | [H+].C(N(CC)CC)CCN=C(N)N=C(N)N.[Cl-] |
| InChI | 1S/C9H22N6.ClH/c1-3-15(4-2)7-5-6-13-9(12)14-8(10)11;/h3-7H2,1-2H3,(H6,10,11,12,13,14);1H |
| InChIKey | GBNPLWLDSSLHCE-UHFFFAOYSA-N |
| Boiling point | 370.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 178.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(Diethylamino)Propyl]Biguanide Monohydrochloride |