|
CAS#: 94135-07-6 Product: 4-Methylpentyl 2-Methylcrotonate No suppilers available for the product. |
| Name | 4-Methylpentyl 2-Methylcrotonate |
|---|---|
| Synonyms | Isohexyl (E)-2-Methylbut-2-Enoate; (E)-2-Methylbut-2-Enoic Acid Isohexyl Ester; 4-Methylpentyl 2-Methylcrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 94135-07-6 |
| EINECS | 302-875-7 |
| SMILES | C(OC(=O)C(=C/C)/C)CCC(C)C |
| InChI | 1S/C11H20O2/c1-5-10(4)11(12)13-8-6-7-9(2)3/h5,9H,6-8H2,1-4H3/b10-5+ |
| InChIKey | IGQMPEJHZCJCHT-BJMVGYQFSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.509°C at 760 mmHg (Cal.) |
| Flash point | 84.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylpentyl 2-Methylcrotonate |