|
CAS#: 94135-91-8 Product: 1-(4-Fluorophenyl)piperazin-1-ium acetate No suppilers available for the product. |
| Name | 1-(4-Fluorophenyl)piperazin-1-ium acetate |
|---|---|
| Synonyms | 1-(p-fluorophenyl)piperazinium acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.27 |
| CAS Registry Number | 94135-91-8 |
| EINECS | 302-963-5 |
| SMILES | [O-]C(C)=O.Fc1ccc(cc1)[NH+]2CCNCC2 |
| InChI | 1S/C10H13FN2.C2H4O2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;1-2(3)4/h1-4,12H,5-8H2;1H3,(H,3,4) |
| InChIKey | WONJAZCBCOIPRF-UHFFFAOYSA-N |
| Boiling point | 430.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 214.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Fluorophenyl)piperazin-1-ium acetate |