|
CAS#: 94135-96-3 Product: 5,5-Dimethyl-3-Decen-2-One No suppilers available for the product. |
| Name | 5,5-Dimethyl-3-Decen-2-One |
|---|---|
| Synonyms | 5,5-Dimethyl-3-Decen-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 94135-96-3 |
| EINECS | 302-968-2 |
| SMILES | C(C(\C=C\C(=O)C)(C)C)CCCC |
| InChI | 1S/C12H22O/c1-5-6-7-9-12(3,4)10-8-11(2)13/h8,10H,5-7,9H2,1-4H3/b10-8+ |
| InChIKey | FEDALTYBCNYVKG-CSKARUKUSA-N |
| Density | 0.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.37°C at 760 mmHg (Cal.) |
| Flash point | 113.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-3-Decen-2-One |