|
CAS#: 94157-86-5 Product: Phenyl Cyclohexanepropionate No suppilers available for the product. |
| Name | Phenyl Cyclohexanepropionate |
|---|---|
| Synonyms | 2-(1-Phenylcyclohexyl)Propionate; Phenyl Cyclohexanepropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19O2 |
| Molecular Weight | 231.31 |
| CAS Registry Number | 94157-86-5 |
| EINECS | 303-054-6 |
| SMILES | C2=C(C1(C(C([O-])=O)C)CCCCC1)C=CC=C2 |
| InChI | 1S/C15H20O2/c1-12(14(16)17)15(10-6-3-7-11-15)13-8-4-2-5-9-13/h2,4-5,8-9,12H,3,6-7,10-11H2,1H3,(H,16,17)/p-1 |
| InChIKey | JRIFYGUKKSGEEV-UHFFFAOYSA-M |
| Boiling point | 379.411°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 276.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl Cyclohexanepropionate |