|
CAS#: 94158-58-4 Product: Bis(N,N-diethylethanaminium) glutarate No suppilers available for the product. |
| Name | Bis(N,N-diethylethanaminium) glutarate |
|---|---|
| Synonyms | bis(triethylammonium) glutarate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H38N2O4 |
| Molecular Weight | 334.49 |
| CAS Registry Number | 94158-58-4 |
| EINECS | 303-130-9 |
| SMILES | [O-]C(=O)CCCC([O-])=O.CC[NH+](CC)CC.CC[NH+](CC)CC |
| InChI | 1S/2C6H15N.C5H8O4/c2*1-4-7(5-2)6-3;6-4(7)2-1-3-5(8)9/h2*4-6H2,1-3H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | GOBWKURIHUUSBC-UHFFFAOYSA-N |
| Boiling point | 447.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(N,N-diethylethanaminium) glutarate |