Online Database of Chemicals from Around the World
|
CAS#: 94159-88-3 Product: 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)-2,2-Dimethyl-1,3-Dioxolane No suppilers available for the product. |
| Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)-2,2-Dimethyl-1,3-Dioxolane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H11F17O2 |
| Molecular Weight | 534.21 |
| CAS Registry Number | 94159-88-3 |
| EINECS | 303-270-0 |
| SMILES | C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1OC(OC1)(C)C |
| InChI | 1S/C14H11F17O2/c1-6(2)32-4-5(33-6)3-7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h5H,3-4H2,1-2H3 |
| InChIKey | UCXJEPZAXJRBAT-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.55°C at 760 mmHg (Cal.) |
| Flash point | 113.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)-2,2-Dimethyl-1,3-Dioxolane |