|
CAS#: 94166-66-2 Product: N2-Phenylpyridine-2,5-Diamine Hydrochloride No suppilers available for the product. |
| Name | N2-Phenylpyridine-2,5-Diamine Hydrochloride |
|---|---|
| Synonyms | (5-Amino-2-Pyridyl)-Phenyl-Amine Hydrochloride; N2-Phenylpyridine-2,5-Diamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 |
| CAS Registry Number | 94166-66-2 (26878-30-8) |
| EINECS | 303-363-6 |
| SMILES | [H+].C2=C(NC1=NC=C(N)C=C1)C=CC=C2.[Cl-] |
| InChI | 1S/C11H11N3.ClH/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10;/h1-8H,12H2,(H,13,14);1H |
| InChIKey | MNGBLMSZAYCLBI-UHFFFAOYSA-N |
| Boiling point | 379.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-Phenylpyridine-2,5-Diamine Hydrochloride |