|
CAS#: 94200-27-8 Product: 2,4-Bis-(2,2,3-Trimethylcyclopent-3-Enyl)Butanol No suppilers available for the product. |
| Name | 2,4-Bis-(2,2,3-Trimethylcyclopent-3-Enyl)Butanol |
|---|---|
| Synonyms | 2,4-Bis-(2,2,3-Trimethylcyclopent-3-Enyl)Butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 |
| CAS Registry Number | 94200-27-8 |
| EINECS | 303-503-6 |
| SMILES | C(C1C(C(=CC1)C)(C)C)CC(C2C(C(=CC2)C)(C)C)CO |
| InChI | 1S/C20H34O/c1-14-7-10-17(19(14,3)4)11-9-16(13-21)18-12-8-15(2)20(18,5)6/h7-8,16-18,21H,9-13H2,1-6H3 |
| InChIKey | FATSIAZXFSKJQU-UHFFFAOYSA-N |
| Density | 0.911g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.886°C at 760 mmHg (Cal.) |
| Flash point | 118.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis-(2,2,3-Trimethylcyclopent-3-Enyl)Butanol |