|
CAS#: 94200-32-5 Product: 4-(1-Phenylethyl)Phenyl Dihydrogen Phosphate No suppilers available for the product. |
| Name | 4-(1-Phenylethyl)Phenyl Dihydrogen Phosphate |
|---|---|
| Synonyms | P-(1-Phenylethyl)Phenyl Dihydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15O4P |
| Molecular Weight | 278.24 |
| CAS Registry Number | 94200-32-5 |
| EINECS | 303-508-3 |
| SMILES | C2=C(C(C1=CC=CC=C1)C)C=CC(=C2)O[P](O)(O)=O |
| InChI | 1S/C14H15O4P/c1-11(12-5-3-2-4-6-12)13-7-9-14(10-8-13)18-19(15,16)17/h2-11H,1H3,(H2,15,16,17) |
| InChIKey | GOQMSORPLCOQCQ-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.397°C at 760 mmHg (Cal.) |
| Flash point | 226.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Phenylethyl)Phenyl Dihydrogen Phosphate |