|
CAS#: 94200-80-3 Product: Bis(4-Amino-4,5-Dihydro-5-Oxo-1-Phenyl-1H-Pyrazole-3-Carboxamidine) Sulphate No suppilers available for the product. |
| Name | Bis(4-Amino-4,5-Dihydro-5-Oxo-1-Phenyl-1H-Pyrazole-3-Carboxamidine) Sulphate |
|---|---|
| Synonyms | bis(4-ami |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N10O6S |
| Molecular Weight | 532.53 |
| CAS Registry Number | 94200-80-3 |
| EINECS | 303-560-7 |
| SMILES | OS(O)(=O)=O.NC(=N)C2=NN(c1ccccc1)C(=O)C2N.NC(=N)C2=NN(c1ccccc1)C(=O)C2N |
| InChI | 1S/2C10H11N5O.H2O4S/c2*11-7-8(9(12)13)14-15(10(7)16)6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5,7H,11H2,(H3,12,13);(H2,1,2,3,4) |
| InChIKey | PGUQPWMRUMKVQG-UHFFFAOYSA-N |
| Boiling point | 772°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 420.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Amino-4,5-Dihydro-5-Oxo-1-Phenyl-1H-Pyrazole-3-Carboxamidine) Sulphate |