|
CAS#: 94201-04-4 Product: 4-(1,3-dimethylbuta-1,3-dienyl)-3,7,7-trimethyl-bicyclo[4.1.0]hept-2-ene No suppilers available for the product. |
| Name | 4-(1,3-dimethylbuta-1,3-dienyl)-3,7,7-trimethyl-bicyclo[4.1.0]hept-2-ene |
|---|---|
| Synonyms | 4-(1,3-di |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.36 |
| CAS Registry Number | 94201-04-4 |
| EINECS | 303-585-3 |
| SMILES | CC2(C)C1/C=C(/C)C(CC12)C(C)=CC(C)=C |
| InChI | 1S/C16H24/c1-10(2)7-11(3)13-9-15-14(8-12(13)4)16(15,5)6/h7-8,13-15H,1,9H2,2-6H3 |
| InChIKey | IPOZECBFFCTICQ-UHFFFAOYSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.469°C at 760 mmHg (Cal.) |
| Flash point | 110.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,3-dimethylbuta-1,3-dienyl)-3,7,7-trimethyl-bicyclo[4.1.0]hept-2-ene |