|
CAS#: 94201-24-8 Product: 2-Methyl-3-(2,6,6-Trimethylcyclohex-2-En-1-Ylidene)Propanol No suppilers available for the product. |
| Name | 2-Methyl-3-(2,6,6-Trimethylcyclohex-2-En-1-Ylidene)Propanol |
|---|---|
| Synonyms | 2-Methyl-3-(2,6,6-Trimethylcyclohex-2-En-1-Ylidene)Propanol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 94201-24-8 |
| EINECS | 303-608-7 |
| SMILES | C(O)C(\C=C/1C(CCC=C1C)(C)C)C |
| InChI | 1S/C13H22O/c1-10(9-14)8-12-11(2)6-5-7-13(12,3)4/h6,8,10,14H,5,7,9H2,1-4H3/b12-8+ |
| InChIKey | RVYMPTPRZXBDOF-XYOKQWHBSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.295°C at 760 mmHg (Cal.) |
| Flash point | 105.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(2,6,6-Trimethylcyclohex-2-En-1-Ylidene)Propanol |