|
CAS#: 94201-34-0 Product: 2,4,8-Trimethylnona-1,7-Dien-4-Ol No suppilers available for the product. |
| Name | 2,4,8-Trimethylnona-1,7-Dien-4-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 94201-34-0 |
| EINECS | 303-619-7 |
| SMILES | C(C(O)(CCC=C(C)C)C)C(=C)C |
| InChI | 1S/C12H22O/c1-10(2)7-6-8-12(5,13)9-11(3)4/h7,13H,3,6,8-9H2,1-2,4-5H3 |
| InChIKey | YSPKCLKSIHQLPT-UHFFFAOYSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.612°C at 760 mmHg (Cal.) |
| Flash point | 96.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,8-Trimethylnona-1,7-Dien-4-Ol |